Carboxylic acids and derivatives
Filtered Search Results
Triethyl citrate, 99%
CAS: 77-93-0 Molecular Formula: C12H20O7 Molecular Weight (g/mol): 276.285 MDL Number: MFCD00009201 InChI Key: DOOTYTYQINUNNV-UHFFFAOYSA-N Synonym: triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester PubChem CID: 6506 IUPAC Name: triethyl 2-hydroxypropane-1,2,3-tricarboxylate SMILES: CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O
| PubChem CID | 6506 |
|---|---|
| CAS | 77-93-0 |
| Molecular Weight (g/mol) | 276.285 |
| MDL Number | MFCD00009201 |
| SMILES | CCOC(=O)CC(CC(=O)OCC)(C(=O)OCC)O |
| Synonym | triethyl citrate,ethyl citrate,citroflex 2,eudraflex,hydragen cat,citric acid, triethyl ester,triaethylcitrat,triethylcitrate,citric acid triethyl ester,1,2,3-propanetricarboxylic acid, 2-hydroxy-, triethyl ester |
| IUPAC Name | triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | DOOTYTYQINUNNV-UHFFFAOYSA-N |
| Molecular Formula | C12H20O7 |
Sodium formate, ACS reagent
CAS: 141-53-7 Molecular Formula: CHNaO2 Molecular Weight (g/mol): 68.01 InChI Key: HLBBKKJFGFRGMU-UHFFFAOYSA-M Synonym: sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 PubChem CID: 2723810 ChEBI: CHEBI:62965 IUPAC Name: sodium;formate SMILES: C(=O)[O-].[Na+]
| PubChem CID | 2723810 |
|---|---|
| CAS | 141-53-7 |
| Molecular Weight (g/mol) | 68.01 |
| ChEBI | CHEBI:62965 |
| SMILES | C(=O)[O-].[Na+] |
| Synonym | sodium formate,formic acid, sodium salt,salachlor,formic acid sodium salt,formic acid, na salt,sodium formate, refined,sodium formiate,mravencan sodny czech,ccris 1037,hsdb 744 |
| IUPAC Name | sodium;formate |
| InChI Key | HLBBKKJFGFRGMU-UHFFFAOYSA-M |
| Molecular Formula | CHNaO2 |
DL-Isocitric acid, trisodium salt hydrate, 95%
CAS: 1637-73-6 Molecular Formula: C6H5Na3O7 Molecular Weight (g/mol): 258.07 MDL Number: MFCD00149284 InChI Key: HWMVXEKEEAIYGB-UHFFFAOYNA-K Synonym: dl-isocitric acid,isocitric acid trisodium salt,sodium isocitrate,dl-isocitric acid trisodium salt hydrate,dl-isocitric acid trisodium salt,trisodium 1-hydroxypropane-1,2,3-tricarboxylate,trisodium isocitrate,tripotassium isocitrate,isocitric acid, dl,dl-isocitric acid, trisodium salt hydrate PubChem CID: 168942 IUPAC Name: trisodium;1-hydroxypropane-1,2,3-tricarboxylate SMILES: [Na+].[Na+].[Na+].OC(C(CC([O-])=O)C([O-])=O)C([O-])=O
| PubChem CID | 168942 |
|---|---|
| CAS | 1637-73-6 |
| Molecular Weight (g/mol) | 258.07 |
| MDL Number | MFCD00149284 |
| SMILES | [Na+].[Na+].[Na+].OC(C(CC([O-])=O)C([O-])=O)C([O-])=O |
| Synonym | dl-isocitric acid,isocitric acid trisodium salt,sodium isocitrate,dl-isocitric acid trisodium salt hydrate,dl-isocitric acid trisodium salt,trisodium 1-hydroxypropane-1,2,3-tricarboxylate,trisodium isocitrate,tripotassium isocitrate,isocitric acid, dl,dl-isocitric acid, trisodium salt hydrate |
| IUPAC Name | trisodium;1-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | HWMVXEKEEAIYGB-UHFFFAOYNA-K |
| Molecular Formula | C6H5Na3O7 |
Gluconic acid, sodium salt, 98%
CAS: 527-07-1 Molecular Formula: C6H11NaO7 Molecular Weight (g/mol): 218.137 MDL Number: MFCD00064210 InChI Key: UPMFZISCCZSDND-JJKGCWMISA-M Synonym: sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t PubChem CID: 23672301 ChEBI: CHEBI:84997 IUPAC Name: sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate SMILES: C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+]
| PubChem CID | 23672301 |
|---|---|
| CAS | 527-07-1 |
| Molecular Weight (g/mol) | 218.137 |
| ChEBI | CHEBI:84997 |
| MDL Number | MFCD00064210 |
| SMILES | C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
| Synonym | sodium gluconate,sodium d-gluconate,d-gluconic acid sodium salt,d-gluconic acid, monosodium salt,gluconic acid sodium salt,monosodium gluconate,glonsen,monosodium d-gluconate,gluconate sodium,pasexon 100t |
| IUPAC Name | sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChI Key | UPMFZISCCZSDND-JJKGCWMISA-M |
| Molecular Formula | C6H11NaO7 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate, 99.5%, for molecular biology, DNAse, RNAse and Protease free
CAS: 13235-36-4 Molecular Formula: C10H20N2Na4O12 Molecular Weight (g/mol): 452.23 MDL Number: MFCD00150027 InChI Key: XFLNVMPCPRLYBE-UHFFFAOYSA-J Synonym: tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 PubChem CID: 23287279 IUPAC Name: tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrahydrate SMILES: O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 23287279 |
|---|---|
| CAS | 13235-36-4 |
| Molecular Weight (g/mol) | 452.23 |
| MDL Number | MFCD00150027 |
| SMILES | O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 |
| IUPAC Name | tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;tetrahydrate |
| InChI Key | XFLNVMPCPRLYBE-UHFFFAOYSA-J |
| Molecular Formula | C10H20N2Na4O12 |
Thermo Scientific Chemicals Ethylenediaminetetraacetic acid, 0.5M aq. soln, pH 8.0
CAS: 60-00-4 Molecular Formula: C10H16N2O8 Molecular Weight (g/mol): 292.24 MDL Number: MFCD00003541 InChI Key: KCXVZYZYPLLWCC-UHFFFAOYSA-N Synonym: edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol PubChem CID: 6049 ChEBI: CHEBI:42191 IUPAC Name: 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid SMILES: OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O
| PubChem CID | 6049 |
|---|---|
| CAS | 60-00-4 |
| Molecular Weight (g/mol) | 292.24 |
| ChEBI | CHEBI:42191 |
| MDL Number | MFCD00003541 |
| SMILES | OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
| Synonym | edta,edetic acid,ethylenediaminetetraacetic acid,edathamil,versene,endrate,havidote,titriplex,edta acid,sequestrol |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | KCXVZYZYPLLWCC-UHFFFAOYSA-N |
| Molecular Formula | C10H16N2O8 |
3-Mercaptopropionic acid, 99%
CAS: 107-96-0 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.139 MDL Number: MFCD00004897 InChI Key: DKIDEFUBRARXTE-UHFFFAOYSA-N Synonym: 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid PubChem CID: 6514 ChEBI: CHEBI:44111 IUPAC Name: 3-sulfanylpropanoic acid SMILES: C(CS)C(=O)O
| PubChem CID | 6514 |
|---|---|
| CAS | 107-96-0 |
| Molecular Weight (g/mol) | 106.139 |
| ChEBI | CHEBI:44111 |
| MDL Number | MFCD00004897 |
| SMILES | C(CS)C(=O)O |
| Synonym | 3-mercaptopropionic acid,3-mercaptopropanoic acid,3-thiopropionic acid,3-thiopropanoic acid,propanoic acid, 3-mercapto,beta-mercaptopropionic acid,3mpa,mercaptopropionic acid,beta-thiopropionic acid,2-mercaptoethanecarboxylic acid |
| IUPAC Name | 3-sulfanylpropanoic acid |
| InChI Key | DKIDEFUBRARXTE-UHFFFAOYSA-N |
| Molecular Formula | C3H6O2S |
Acetic acid, glacial, 99+%
CAS: 64-19-7 Molecular Formula: C2H4O2 Molecular Weight (g/mol): 60.05 MDL Number: MFCD00036152 InChI Key: QTBSBXVTEAMEQO-UHFFFAOYSA-N Synonym: ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure PubChem CID: 176 ChEBI: CHEBI:15366 IUPAC Name: acetic acid SMILES: CC(O)=O
| PubChem CID | 176 |
|---|---|
| CAS | 64-19-7 |
| Molecular Weight (g/mol) | 60.05 |
| ChEBI | CHEBI:15366 |
| MDL Number | MFCD00036152 |
| SMILES | CC(O)=O |
| Synonym | ethanoic acid,ethylic acid,acetic acid, glacial,methanecarboxylic acid,vinegar acid,glacial,acetasol,acide acetique,essigsaeure |
| IUPAC Name | acetic acid |
| InChI Key | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Molecular Formula | C2H4O2 |
Tris(2-carboxyethyl)phosphine Hydrochloride 98.0+%, TCI America™
CAS: 51805-45-9 Molecular Formula: C9H12O6P Molecular Weight (g/mol): 247.16 MDL Number: MFCD00145469 InChI Key: PZBFGYYEXUXCOF-UHFFFAOYSA-K Synonym: tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride PubChem CID: 2734570 IUPAC Name: 3-[bis(2-carboxylatoethyl)phosphanyl]propanoate SMILES: [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O
| PubChem CID | 2734570 |
|---|---|
| CAS | 51805-45-9 |
| Molecular Weight (g/mol) | 247.16 |
| MDL Number | MFCD00145469 |
| SMILES | [O-]C(=O)CCP(CCC([O-])=O)CCC([O-])=O |
| Synonym | tris 2-carboxyethyl phosphine hydrochloride,tcep hcl,tcep hydrochloride,3,3',3-phosphinetriyltripropanoic acid hydrochloride,tcep,unii-h49aam893k,tris carboxyethyl phosphine hydrochloride,tris-2-carboxyethyl phosphine hydrochloride,tris 2-carboxyethyl phosphine hcl,3,3',3-phosphinetriyltripropanoicacidhydrochloride |
| IUPAC Name | 3-[bis(2-carboxylatoethyl)phosphanyl]propanoate |
| InChI Key | PZBFGYYEXUXCOF-UHFFFAOYSA-K |
| Molecular Formula | C9H12O6P |
2-(Dimethylamino)ethyl methacrylate, 99%, stabilized
CAS: 2867-47-2 Molecular Formula: C8H15NO2 Molecular Weight (g/mol): 157.21 MDL Number: MFCD00008589 InChI Key: JKNCOURZONDCGV-UHFFFAOYSA-N Synonym: 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate PubChem CID: 17869 IUPAC Name: 2-(dimethylamino)ethyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCCN(C)C
| PubChem CID | 17869 |
|---|---|
| CAS | 2867-47-2 |
| Molecular Weight (g/mol) | 157.21 |
| MDL Number | MFCD00008589 |
| SMILES | CC(=C)C(=O)OCCN(C)C |
| Synonym | 2-dimethylamino ethyl methacrylate,dimethylaminoethyl methacrylate,ageflex fm-1,dmaema,usaf rh-3,2-propenoic acid, 2-methyl-, 2-dimethylamino ethyl ester,2-n,n-dimethylamino ethyl methacrylate,n,n-dimethylaminoethyl methacrylate,2-dimethylaminoethyl methacrylate,n,n-dimethylethanolamine methacrylate |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate |
| InChI Key | JKNCOURZONDCGV-UHFFFAOYSA-N |
| Molecular Formula | C8H15NO2 |
Ethylenediaminetetraacetic acid disodium salt, 0.100N (0.050M) Standardized solution
CAS: 139-33-3 Molecular Formula: C10H14N2Na2O8 Molecular Weight (g/mol): 336.21 MDL Number: MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 InChI Key: ZGTMUACCHSMWAC-UHFFFAOYSA-L Synonym: ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid PubChem CID: 57339238 ChEBI: CHEBI:64734 IUPAC Name: disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate SMILES: [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 57339238 |
|---|---|
| CAS | 139-33-3 |
| Molecular Weight (g/mol) | 336.21 |
| ChEBI | CHEBI:64734 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | ethylenediaminetetraacetic acid disodium salt,edta na2,disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| Molecular Formula | C10H14N2Na2O8 |
Methyl methacrylate, 99%, stabilized
CAS: 80-62-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.12 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| Molecular Weight (g/mol) | 100.12 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| SMILES | CC(=C)C(=O)OC |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Cobalt(II) acetate tetrahydrate, 98%
CAS: 6147-53-1 Molecular Formula: C4H14CoO8 MDL Number: MFCD00149569 InChI Key: ZBYYWKJVSFHYJL-UHFFFAOYSA-L Synonym: cobalt ii acetate tetrahydrate,cobalt acetate tetrahydrate,cobaltous acetate tetrahydrate,cobalt diacetate tetrahydrate,bis acetato tetraquacobalt,octan kobaltnaty czech,acetic acid, cobalt 2+ salt, tetrahydrate,octan kobaltnaty,ccris 9441 PubChem CID: 61372
| PubChem CID | 61372 |
|---|---|
| CAS | 6147-53-1 |
| MDL Number | MFCD00149569 |
| Synonym | cobalt ii acetate tetrahydrate,cobalt acetate tetrahydrate,cobaltous acetate tetrahydrate,cobalt diacetate tetrahydrate,bis acetato tetraquacobalt,octan kobaltnaty czech,acetic acid, cobalt 2+ salt, tetrahydrate,octan kobaltnaty,ccris 9441 |
| InChI Key | ZBYYWKJVSFHYJL-UHFFFAOYSA-L |
| Molecular Formula | C4H14CoO8 |
Methyl methacrylate, 99%, stab.
CAS: 80-62-6 Molecular Formula: C5H8O2 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one, 97%
CAS: 5381-99-7 Molecular Formula: C7H4ClO3P Molecular Weight (g/mol): 202.53 MDL Number: MFCD00013353 InChI Key: BVOITXUNGDUXRW-UHFFFAOYNA-N Synonym: 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent PubChem CID: 237010 IUPAC Name: 2-chloro-1,3,2-benzodioxaphosphinin-4-one SMILES: ClP1OC(=O)C2=CC=CC=C2O1
| PubChem CID | 237010 |
|---|---|
| CAS | 5381-99-7 |
| Molecular Weight (g/mol) | 202.53 |
| MDL Number | MFCD00013353 |
| SMILES | ClP1OC(=O)C2=CC=CC=C2O1 |
| Synonym | 2-chloro-4h-1,3,2-benzodioxaphosphorin-4-one,2-chloro-4h-benzo d 1,3,2 dioxaphosphinin-4-one,van boom's reagent,2-chloro-4h-1,2,3-benzodioxaphosphorin-4-one,4h-1,3,2-benzodioxaphosphorin-4-one, 2-chloro,salicylchlorophosphite,salicyl chlorophosphite,acmc-1an3b,2-chloro-4h-1,3,2-benzodioxaphosphinin-4-one,salicylchlorophosphite; van boom's reagent |
| IUPAC Name | 2-chloro-1,3,2-benzodioxaphosphinin-4-one |
| InChI Key | BVOITXUNGDUXRW-UHFFFAOYNA-N |
| Molecular Formula | C7H4ClO3P |